* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-AZATRICYCLO[9.4.0.0(2,7)]PENTADECA-1(11),2(7),3,5,12,14-HEXAENE |
English Synonyms: | 8-AZATRICYCLO[9.4.0.0(2,7)]PENTADECA-1(11),2(7),3,5,12,14-HEXAENE |
MDL Number.: | MFCD16990727 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc-2c(c1)CCNc3c2cccc3 |
InChi: | InChI=1S/C14H13N/c1-2-6-12-11(5-1)9-10-15-14-8-4-3-7-13(12)14/h1-8,15H,9-10H2 |
InChiKey: | InChIKey=DPTWHLYOYXIHOG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.