* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,9-DIFLUORO-3-AZABICYCLO[3.3.1]NONANE |
English Synonyms: | 9,9-DIFLUORO-3-AZABICYCLO[3.3.1]NONANE |
MDL Number.: | MFCD16990751 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C1C[C@H]2CNC[C@@H](C1)C2(F)F |
InChi: | InChI=1S/C8H13F2N/c9-8(10)6-2-1-3-7(8)5-11-4-6/h6-7,11H,1-5H2/t6-,7+ |
InChiKey: | InChIKey=NGVPSBONRJASED-KNVOCYPGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.