* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-ETHOXY-2,3,4,5-TETRAHYDRO-1,4-BENZOXAZEPINE |
English Synonyms: | 9-ETHOXY-2,3,4,5-TETRAHYDRO-1,4-BENZOXAZEPINE |
MDL Number.: | MFCD16991113 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCOc1cccc2c1OCCNC2 |
InChi: | InChI=1S/C11H15NO2/c1-2-13-10-5-3-4-9-8-12-6-7-14-11(9)10/h3-5,12H,2,6-8H2,1H3 |
InChiKey: | InChIKey=NYLULYMPHJAUKB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.