* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-FLUORO-2,3,4,5-TETRAHYDRO-1,4-BENZOXAZEPINE |
| English Synonyms: | 7-FLUORO-2,3,4,5-TETRAHYDRO-1,4-BENZOXAZEPINE |
| MDL Number.: | MFCD16991116 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cc1F)CNCCO2 |
| InChi: | InChI=1S/C9H10FNO/c10-8-1-2-9-7(5-8)6-11-3-4-12-9/h1-2,5,11H,3-4,6H2 |
| InChiKey: | InChIKey=MBGJLGVSYZIMCV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.