* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FURO[2',3':4,5]PYRROLO[1,2-D][1,2,4]TRIAZINE-8(7H)-THIONE |
| English Synonyms: | FURO[2',3':4,5]PYRROLO[1,2-D][1,2,4]TRIAZINE-8(7H)-THIONE |
| MDL Number.: | MFCD16991199 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1coc2c1n3cn[nH]c(=S)c3c2 |
| InChi: | InChI=1S/C8H5N3OS/c13-8-6-3-7-5(1-2-12-7)11(6)4-9-10-8/h1-4H,(H,10,13) |
| InChiKey: | InChIKey=HOWXUEBXXJECLU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.