* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMDIV-BB BB51-1662 |
English Synonyms: | CHEMDIV-BB BB51-1662 |
MDL Number.: | MFCD16991204 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCc1cccc(c1)NC2c3ccoc3C=C(N2C)C(=O)O |
InChi: | InChI=1S/C17H18N2O3/c1-3-11-5-4-6-12(9-11)18-16-13-7-8-22-15(13)10-14(17(20)21)19(16)2/h4-10,16,18H,3H2,1-2H3,(H,20,21) |
InChiKey: | InChIKey=LCUUHTIPSRVJSM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.