* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CHEMDIV-BB BB51-1665 |
English Synonyms: | CHEMDIV-BB BB51-1665 |
MDL Number.: | MFCD16991207 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CN1C(c2ccoc2C=C1C(=O)O)Nc3ccc(cc3)OC |
InChi: | InChI=1S/C16H16N2O4/c1-18-13(16(19)20)9-14-12(7-8-22-14)15(18)17-10-3-5-11(21-2)6-4-10/h3-9,15,17H,1-2H3,(H,19,20) |
InChiKey: | InChIKey=PWGZNIOSDYKRCT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.