* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(2-PHENYL-3H-IMIDAZO[4,5-B]PYRIDIN-3-YL)BENZOIC ACID |
| English Synonyms: | 4-(2-PHENYL-3H-IMIDAZO[4,5-B]PYRIDIN-3-YL)BENZOIC ACID |
| MDL Number.: | MFCD16991332 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)c2nc3cccnc3n2c4ccc(cc4)C(=O)O |
| InChi: | InChI=1S/C19H13N3O2/c23-19(24)14-8-10-15(11-9-14)22-17(13-5-2-1-3-6-13)21-16-7-4-12-20-18(16)22/h1-12H,(H,23,24) |
| InChiKey: | InChIKey=RBSRIXIPPHSVLO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.