* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-METHYL-5-(2-METHYLPHENYL)-6-PROPYL-1,3-DIHYDRO-2H-THIENO[2,3-E][1,4]DIAZEPIN-2-ONE |
| English Synonyms: | 7-METHYL-5-(2-METHYLPHENYL)-6-PROPYL-1,3-DIHYDRO-2H-THIENO[2,3-E][1,4]DIAZEPIN-2-ONE |
| MDL Number.: | MFCD16991525 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCc1c(sc2c1C(=NCC(=O)N2)c3ccccc3C)C |
| InChi: | InChI=1S/C18H20N2OS/c1-4-7-14-12(3)22-18-16(14)17(19-10-15(21)20-18)13-9-6-5-8-11(13)2/h5-6,8-9H,4,7,10H2,1-3H3,(H,20,21) |
| InChiKey: | InChIKey=GEKSRUDYTMPQSL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.