* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6,8-DIMETHYL-2,3-DIHYDRO-1H-PYRIDO[2,3-B][1,4]THIAZINE |
| English Synonyms: | 6,8-DIMETHYL-2,3-DIHYDRO-1H-PYRIDO[2,3-B][1,4]THIAZINE ; 6,8-DIMETHYL-1H,2H,3H-PYRIDO[2,3-B][1,4]THIAZINE |
| MDL Number.: | MFCD16991713 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1cc(nc2c1NCCS2)C |
| InChi: | InChI=1S/C9H12N2S/c1-6-5-7(2)11-9-8(6)10-3-4-12-9/h5,10H,3-4H2,1-2H3 |
| InChiKey: | InChIKey=TUSQDZBOCKLVER-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.