* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-ACETYL-4-METHYL-5,6,7,8,9,10-HEXAHYDRO-4H-PYRIDO[4',3':4,5]THIENO[3,2-F]PYRROLO[1,2-A][1,4]DIAZEPINE |
English Synonyms: | 9-ACETYL-4-METHYL-5,6,7,8,9,10-HEXAHYDRO-4H-PYRIDO[4',3':4,5]THIENO[3,2-F]PYRROLO[1,2-A][1,4]DIAZEPINE |
MDL Number.: | MFCD16991797 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1c2cccn2-c3c(c4c(s3)CN(CC4)C(=O)C)CN1 |
InChi: | InChI=1S/C16H19N3OS/c1-10-14-4-3-6-19(14)16-13(8-17-10)12-5-7-18(11(2)20)9-15(12)21-16/h3-4,6,10,17H,5,7-9H2,1-2H3 |
InChiKey: | InChIKey=SWAFDLAEODUGOT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.