* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-METHYL-BENZO[1,2-D:3,4-D']BISTHIAZOLE-2,7-DIAMINE |
English Synonyms: | ZERENEX E/1103724 ; 4-METHYL-BENZO[1,2-D:3,4-D']BISTHIAZOLE-2,7-DIAMINE |
MDL Number.: | MFCD16992813 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1cc2c(c3c1nc(s3)N)nc(s2)N |
InChi: | InChI=1S/C9H8N4S2/c1-3-2-4-6(13-8(10)14-4)7-5(3)12-9(11)15-7/h2H,1H3,(H2,10,13)(H2,11,12) |
InChiKey: | InChIKey=HFEYKDDGRTZSMT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.