* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DIBUTYL-(4-[1,2,4]TRIAZOL-4-YL-BENZYL)-AMINE |
| English Synonyms: | ZERENEX E/1103746 ; DIBUTYL-(4-[1,2,4]TRIAZOL-4-YL-BENZYL)-AMINE |
| MDL Number.: | MFCD16992832 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCCCN(CCCC)Cc1ccc(cc1)n2cnnc2 |
| InChi: | InChI=1S/C17H26N4/c1-3-5-11-20(12-6-4-2)13-16-7-9-17(10-8-16)21-14-18-19-15-21/h7-10,14-15H,3-6,11-13H2,1-2H3 |
| InChiKey: | InChIKey=LYZIPPRYXBESMV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.