* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-TERT-BUTYL-2-[1,4]DIAZEPAN-1-YL-PYRIMIDIN-4-OL |
| English Synonyms: | 6-TERT-BUTYL-2-[1,4]DIAZEPAN-1-YL-PYRIMIDIN-4-OL |
| MDL Number.: | MFCD16993311 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)c1cc(nc(n1)N2CCCNCC2)O |
| InChi: | InChI=1S/C13H22N4O/c1-13(2,3)10-9-11(18)16-12(15-10)17-7-4-5-14-6-8-17/h9,14H,4-8H2,1-3H3,(H,15,16,18) |
| InChiKey: | InChIKey=ZPWINNNFVYZWPE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.