* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-ETHYL-2-PIPERIDIN-1-YL-PYRIMIDIN-4-OL |
| English Synonyms: | 6-ETHYL-2-PIPERIDIN-1-YL-PYRIMIDIN-4-OL |
| MDL Number.: | MFCD16993680 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCc1cc(nc(n1)N2CCCCC2)O |
| InChi: | InChI=1S/C11H17N3O/c1-2-9-8-10(15)13-11(12-9)14-6-4-3-5-7-14/h8H,2-7H2,1H3,(H,12,13,15) |
| InChiKey: | InChIKey=FKZQTEUZHOGAAE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.