* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-ETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-PHENOL |
CAS: | 948592-58-3 |
English Synonyms: | 2-ETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-PHENOL ; PHENOL, 2-ETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)- |
MDL Number.: | MFCD16994286 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2cccc(c2CC)O |
InChi: | InChI=1S/C14H21BO3/c1-6-10-11(8-7-9-12(10)16)15-17-13(2,3)14(4,5)18-15/h7-9,16H,6H2,1-5H3 |
InChiKey: | InChIKey=URMDZJWJIDMMCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.