* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-METHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDIN-2-OL |
| English Synonyms: | 6-METHYL-5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDIN-2-OL |
| MDL Number.: | MFCD16995196 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2ccc(nc2C)O |
| InChi: | InChI=1S/C12H18BNO3/c1-8-9(6-7-10(15)14-8)13-16-11(2,3)12(4,5)17-13/h6-7H,1-5H3,(H,14,15) |
| InChiKey: | InChIKey=VPWOWQWKUWVQRW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.