* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-BROMO-1-METHYL-2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-PYRROLE |
English Synonyms: | 4-BROMO-1-METHYL-2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-PYRROLE |
MDL Number.: | MFCD16995490 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(cn2C)Br |
InChi: | InChI=1S/C11H17BBrNO2/c1-10(2)11(3,4)16-12(15-10)9-6-8(13)7-14(9)5/h6-7H,1-5H3 |
InChiKey: | InChIKey=GVHPIRPXKAUOFQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.