* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ISOINDOLIN-1-ONE |
| English Synonyms: | 7-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ISOINDOLIN-1-ONE |
| MDL Number.: | MFCD16996090 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cccc3c2C(=O)NC3 |
| InChi: | InChI=1S/C14H18BNO3/c1-13(2)14(3,4)19-15(18-13)10-7-5-6-9-8-16-12(17)11(9)10/h5-7H,8H2,1-4H3,(H,16,17) |
| InChiKey: | InChIKey=YPOYNQIKBUIFPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.