* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-FLUORO-2-IODOPHENOL |
CAS: | 186589-87-7 |
English Synonyms: | 5-FLUORO-2-IODOPHENOL ; PHENOL, 5-FLUORO-2-IODO- |
MDL Number.: | MFCD16999912 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(c(cc1F)O)I |
InChi: | InChI=1S/C6H4FIO/c7-4-1-2-5(8)6(9)3-4/h1-3,9H |
InChiKey: | InChIKey=DZXUERYVERNFQU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.