* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1-(3-CHLOROPHENYL)-3-AZABICYCLO[3.1.0]HEXANE |
CAS: | 86215-14-7 |
English Synonyms: | 1-(3-CHLOROPHENYL)-3-AZABICYCLO[3.1.0]HEXANE |
MDL Number.: | MFCD17009997 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(cc(c1)Cl)C23CC2CNC3 |
InChi: | InChI=1S/C11H12ClN/c12-10-3-1-2-8(4-10)11-5-9(11)6-13-7-11/h1-4,9,13H,5-7H2 |
InChiKey: | InChIKey=CKYAGWGYWNTSHN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.