* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH1351428 |
English Synonyms: | FCHGROUP FCH1351428 |
MDL Number.: | MFCD17010065 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | Cc1ccc2c(c1)C(=O)CS(=O)(=O)C2 |
InChi: | InChI=1S/C10H10O3S/c1-7-2-3-8-5-14(12,13)6-10(11)9(8)4-7/h2-4H,5-6H2,1H3 |
InChiKey: | InChIKey=QHJWFCRFCNPLRD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.