* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH1351429 |
| English Synonyms: | FCHGROUP FCH1351429 |
| MDL Number.: | MFCD17010066 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1ccc2c(c1)C(CS(=O)(=O)C2)N |
| InChi: | InChI=1S/C10H13NO2S/c1-7-2-3-8-5-14(12,13)6-10(11)9(8)4-7/h2-4,10H,5-6,11H2,1H3 |
| InChiKey: | InChIKey=DQRDLAXYFSCDFW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.