* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRAZOLO[4,3-C]PYRIDIN-4-ONE, 1,5-DIHYDRO- |
| CAS: | 41373-13-1 |
| English Synonyms: | PYRAZOLO[4,3-C]PYRIDIN-4-ONE, 1,5-DIHYDRO- ; 1,5-DIHYDRO-PYRAZOLO[4,3-C]PYRIDIN-4-ONE |
| MDL Number.: | MFCD17010076 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1c[nH]c(=O)c2c1[nH]nc2 |
| InChi: | InChI=1S/C6H5N3O/c10-6-4-3-8-9-5(4)1-2-7-6/h1-3H,(H,7,10)(H,8,9) |
| InChiKey: | InChIKey=SWENTSLBISOJDB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.