* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-IODO-5-NITRO-1H-INDAZOLE |
CAS: | 1208228-60-7 |
English Synonyms: | 7-IODO-5-NITRO-1H-INDAZOLE ; INDAZOLE, 7-IODO-5-NITRO- |
MDL Number.: | MFCD17010097 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1c(cc(c2c1cn[nH]2)I)[N+](=O)[O-] |
InChi: | InChI=1S/C7H4IN3O2/c8-6-2-5(11(12)13)1-4-3-9-10-7(4)6/h1-3H,(H,9,10) |
InChiKey: | InChIKey=MHSJDQGRGXXNPF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.