* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PYRAZOLO[3,4-D]PYRIMIDIN-4-AMINE, 3-PHENYL- |
| CAS: | 42754-69-8 |
| English Synonyms: | PYRAZOLO[3,4-D]PYRIMIDIN-4-AMINE, 3-PHENYL- |
| MDL Number.: | MFCD17010188 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)c2c3c(ncnc3[nH]n2)N |
| InChi: | InChI=1S/C11H9N5/c12-10-8-9(7-4-2-1-3-5-7)15-16-11(8)14-6-13-10/h1-6H,(H3,12,13,14,15,16) |
| InChiKey: | InChIKey=JPWZTNIDHIJKIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.