* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL067125 |
English Synonyms: | SYNTHON-LAB SL067125 |
MDL Number.: | MFCD17010424 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)c1ccc(cc1)/C=C\2/C(=O)N/C(=N/c3ccc(cc3)F)/S2 |
InChi: | InChI=1S/C19H17FN2OS/c1-12(2)14-5-3-13(4-6-14)11-17-18(23)22-19(24-17)21-16-9-7-15(20)8-10-16/h3-12H,1-2H3,(H,21,22,23)/b17-11- |
InChiKey: | InChIKey=MQWXEMBNOSTOSC-BOPFTXTBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.