* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL067285 |
English Synonyms: | SYNTHON-LAB SL067285 |
MDL Number.: | MFCD17010426 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1c(cccc1Cl)/N=C\2/NC(=O)/C(=C/c3cc(c(c(c3)Br)O)OC)/S2 |
InChi: | InChI=1S/C18H14BrClN2O3S/c1-9-12(20)4-3-5-13(9)21-18-22-17(24)15(26-18)8-10-6-11(19)16(23)14(7-10)25-2/h3-8,23H,1-2H3,(H,21,22,24)/b15-8- |
InChiKey: | InChIKey=UWEMHZFTJKRPJL-NVNXTCNLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.