* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL067287 |
English Synonyms: | SYNTHON-LAB SL067287 |
MDL Number.: | MFCD17010428 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOc1cccc(c1OC)/C=C\2/C(=O)N/C(=N/c3cccc(c3C)Cl)/S2 |
InChi: | InChI=1S/C20H19ClN2O3S/c1-4-26-16-10-5-7-13(18(16)25-3)11-17-19(24)23-20(27-17)22-15-9-6-8-14(21)12(15)2/h5-11H,4H2,1-3H3,(H,22,23,24)/b17-11- |
InChiKey: | InChIKey=RDHYXXUGVXOBQM-BOPFTXTBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.