* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH1120036 |
English Synonyms: | FCHGROUP FCH1120036 |
MDL Number.: | MFCD17010672 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(oc1)/C=C/C=N\NC(=O)N |
InChi: | InChI=1S/C8H9N3O2/c9-8(12)11-10-5-1-3-7-4-2-6-13-7/h1-6H,(H3,9,11,12)/b3-1+,10-5- |
InChiKey: | InChIKey=DDGUCOCCCYXUCX-MDDLVQQVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.