* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-ISOPROPYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE |
CAS: | 1253790-64-5 |
English Synonyms: | 1-ISOPROPYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE |
MDL Number.: | MFCD17011891 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC(C)n1c2c(cccn2)c(=O)oc1=O |
InChi: | InChI=1S/C10H10N2O3/c1-6(2)12-8-7(4-3-5-11-8)9(13)15-10(12)14/h3-6H,1-2H3 |
InChiKey: | InChIKey=KYMGYRFOHRYYEY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.