* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-ALLYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE |
| CAS: | 97484-75-8 |
| English Synonyms: | 1-ALLYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE ; 1-(2-PROPEN-1-YL)-2H-PYRIDO[2,3-D][1,3]OXAZINE-2,4(1H)-DIONE |
| MDL Number.: | MFCD17011895 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | C=CCn1c2c(cccn2)c(=O)oc1=O |
| InChi: | InChI=1S/C10H8N2O3/c1-2-6-12-8-7(4-3-5-11-8)9(13)15-10(12)14/h2-5H,1,6H2 |
| InChiKey: | InChIKey=XNSVQPAEYHFRMN-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.