* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-METHYL-1-PHENYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE |
| CAS: | 1253791-80-8 |
| English Synonyms: | 7-METHYL-1-PHENYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE |
| MDL Number.: | MFCD17011911 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | Cc1ccc2c(n1)n(c(=O)oc2=O)c3ccccc3 |
| InChi: | InChI=1S/C14H10N2O3/c1-9-7-8-11-12(15-9)16(14(18)19-13(11)17)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChiKey: | InChIKey=HQKPORSNCLNKLW-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.