* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-PHENYL-1H-PYRIMIDO[4,5-D][1,3]OXAZINE-2,4-DIONE |
| CAS: | 1253791-15-9 |
| English Synonyms: | 7-PHENYL-1H-PYRIMIDO[4,5-D][1,3]OXAZINE-2,4-DIONE |
| MDL Number.: | MFCD17011947 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)c2ncc3c(n2)[nH]c(=O)oc3=O |
| InChi: | InChI=1S/C12H7N3O3/c16-11-8-6-13-9(7-4-2-1-3-5-7)14-10(8)15-12(17)18-11/h1-6H,(H,13,14,15,17) |
| InChiKey: | InChIKey=VWMSPJVWAYRSFA-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.