* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-TYR-THR-NH2 |
English Synonyms: | H-TYR-THR-NH2 |
MDL Number.: | MFCD17011971 |
H bond acceptor: | 7 |
H bond donor: | 5 |
Smile: | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CC1=CC=C(O)C=C1)C(N)=O |
InChi: | InChI=1S/C13H19N3O4/c1-7(17)11(12(15)19)16-13(20)10(14)6-8-2-4-9(18)5-3-8/h2-5,7,10-11,17-18H,6,14H2,1H3,(H2,15,19)(H,16,20)/t7-,10+,11+/m1/s1 |
InChiKey: | InChIKey=ABRCUVDYWRAGGE-GGVZMXCHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.