* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-PHENYL-1H-INDOL-5-AMINE |
CAS: | 6855-64-7 |
English Synonyms: | 5-AMINO-2-PHENYLINDOLE ; 2-PHENYL-1H-INDOL-5-AMINE |
MDL Number.: | MFCD17012057 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)c2cc3cc(ccc3[nH]2)N |
InChi: | InChI=1S/C14H12N2/c15-12-6-7-13-11(8-12)9-14(16-13)10-4-2-1-3-5-10/h1-9,16H,15H2 |
InChiKey: | InChIKey=BQXQPVNUVFCTJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.