* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-HYDROXYLYSINE |
CAS: | 172213-74-0 |
English Synonyms: | L-HYDROXYLYSINE |
MDL Number.: | MFCD17012635 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | C(C[C@@H](C(=O)O)N)[C@@H](CN)O |
InChi: | InChI=1S/C6H14N2O3/c7-3-4(9)1-2-5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11)/t4-,5-/m0/s1 |
InChiKey: | InChIKey=YSMODUONRAFBET-WHFBIAKZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.