* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (2S,3R)-2-AMINO-3-PHENYLBUTANOIC ACID |
CAS: | 25488-27-1 |
English Synonyms: | (2S,3R)-2-AMINO-3-PHENYLBUTANOIC ACID |
MDL Number.: | MFCD17012640 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C[C@H](c1ccccc1)[C@@H](C(=O)O)N |
InChi: | InChI=1S/C10H13NO2/c1-7(9(11)10(12)13)8-5-3-2-4-6-8/h2-7,9H,11H2,1H3,(H,12,13)/t7-,9+/m1/s1 |
InChiKey: | InChIKey=IRZQDMYEJPNDEN-APPZFPTMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.