Molecular Structure:
CCD No.:CCD03284392
2-BROMO-3,5-DIMETHYLTHIOPHENE
CAS No.:
172319-76-5
Formula:C6 H7 Br S
MolWeight:191.091
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | 2-BROMO-3,5-DIMETHYLTHIOPHENE |
| CAS： | 172319-76-5 |
| English Synonyms： | 2-BROMO-3,5-DIMETHYLTHIOPHENE |
| MDL Number.： | MFCD17012744 |
| H bond acceptor： | 0 |
| H bond donor： | 0 |
| Smile： | Cc1cc(sc1Br)C |
| InChi： | InChI=1S/C6H7BrS/c1-4-3-5(2)8-6(4)7/h3H,1-2H3 |
| InChiKey： | InChIKey=RKANUDQVJZLGOO-UHFFFAOYSA-N |
|
|
| Density： | 1.475g/mLat25°C |
| Physical Property： | FLASHPOINT: 186.8 DEG F FLASHPOINT: 86 DEG C REFRACTIVE INDEX: N20/D 1.561 |
| Comments： | STORAGE TEMPERATURE: 2-8 DEG C WGK: 3 |
|
|
| Symbol： |
GHS07
|
| Signal word： | Warning |
| Hazard statements： | H302-H315 |
| hazard symbol： | Xn |
| Risk Code： | R:22-38 |
| Safe Code： | S:36 |
| WGK Germany： | 3 |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
