* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PIPERAZINE-2,3-DIOL |
CAS: | 211620-43-8 |
English Synonyms: | PIPERAZINE-2,3-DIOL |
MDL Number.: | MFCD17012779 |
H bond acceptor: | 4 |
H bond donor: | 4 |
Smile: | C1CNC(C(N1)O)O |
InChi: | InChI=1S/C4H10N2O2/c7-3-4(8)6-2-1-5-3/h3-8H,1-2H2 |
InChiKey: | InChIKey=SLAPHNHYCFZOLU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.