* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-OXA-SPIRO[3.5]NON-6-ENE |
CAS: | 6671-80-3 |
English Synonyms: | 2-OXA-SPIRO[3.5]NON-6-ENE |
MDL Number.: | MFCD17012909 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C1CC2(CC=C1)COC2 |
InChi: | InChI=1S/C8H12O/c1-2-4-8(5-3-1)6-9-7-8/h1-2H,3-7H2 |
InChiKey: | InChIKey=YFWVGNUKWYHJNQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.