* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-METHOXY-4A,5-DIHYDRO-1H-PYRIMIDO[5,4-B]INDOL-4(9BH)-ONE |
| CAS: | 858751-25-4 |
| English Synonyms: | 7-METHOXY-4A,5-DIHYDRO-1H-PYRIMIDO[5,4-B]INDOL-4(9BH)-ONE |
| MDL Number.: | MFCD17013011 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | COc1ccc2c(c1)NC3C2NC=NC3=O |
| InChi: | InChI=1S/C11H11N3O2/c1-16-6-2-3-7-8(4-6)14-10-9(7)12-5-13-11(10)15/h2-5,9-10,14H,1H3,(H,12,13,15) |
| InChiKey: | InChIKey=NDTZSNITCYLYFV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.