* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 6-PHENYL-1H-PYRROLO[3,2-D]PYRIMIDINE-2,4(3H,5H)-DIONE |
CAS: | 34771-39-6 |
English Synonyms: | 1H-PYRROLO[3,2-D]PYRIMIDINE-2,4(3H,5H)-DIONE, 6-PHENYL- ; 6-PHENYL-1H-PYRROLO[3,2-D]PYRIMIDINE-2,4(3H,5H)-DIONE |
MDL Number.: | MFCD17013050 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1ccc(cc1)c2cc3c([nH]2)c(=O)[nH]c(=O)[nH]3 |
InChi: | InChI=1S/C12H9N3O2/c16-11-10-9(14-12(17)15-11)6-8(13-10)7-4-2-1-3-5-7/h1-6,13H,(H2,14,15,16,17) |
InChiKey: | InChIKey=SHQYZHCVGVXICO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.