* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 6-ETHOXY-5H-PYRROLO[3,2-D]PYRIMIDINE |
CAS: | 2227-83-0 |
English Synonyms: | 6-ETHOXY-5H-PYRROLO[3,2-D]PYRIMIDINE |
MDL Number.: | MFCD17013052 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOc1cc2c([nH]1)cncn2 |
InChi: | InChI=1S/C8H9N3O/c1-2-12-8-3-6-7(11-8)4-9-5-10-6/h3-5,11H,2H2,1H3 |
InChiKey: | InChIKey=DXYPHSCFOFVKRE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.