* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHYL-SPIRO[5.5]UNDECAN-3-ONE |
CAS: | 3643-17-2 |
English Synonyms: | SPIRO[5.5]UNDECAN-3-ONE, 9-METHYL- ; 9-METHYL-SPIRO[5.5]UNDECAN-3-ONE |
MDL Number.: | MFCD17013053 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC1CCC2(CC1)CCC(=O)CC2 |
InChi: | InChI=1S/C12H20O/c1-10-2-6-12(7-3-10)8-4-11(13)5-9-12/h10H,2-9H2,1H3 |
InChiKey: | InChIKey=RJUUKXRPGWDNHA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.