* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-OXASPIRO[4.5]DECANE-1,8-DIONE |
CAS: | 67132-93-8 |
English Synonyms: | 2-OXASPIRO[4.5]DECANE-1,8-DIONE |
MDL Number.: | MFCD17013068 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C1CC2(CCC1=O)CCOC2=O |
InChi: | InChI=1S/C9H12O3/c10-7-1-3-9(4-2-7)5-6-12-8(9)11/h1-6H2 |
InChiKey: | InChIKey=LXTRKRHVNREYFJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.