* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-HYDROXY-SPIRO[5.5]UNDECAN-3-ONE |
CAS: | 154464-88-7 |
English Synonyms: | SPIRO[5.5]UNDECAN-3-ONE, 9-HYDROXY- ; 9-HYDROXY-SPIRO[5.5]UNDECAN-3-ONE |
MDL Number.: | MFCD17013072 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1CC2(CCC1O)CCC(=O)CC2 |
InChi: | InChI=1S/C11H18O2/c12-9-1-5-11(6-2-9)7-3-10(13)4-8-11/h9,12H,1-8H2 |
InChiKey: | InChIKey=ZZDXSKAJGIHTQN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.