* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-PYRROLO[2,3-D]PYRIMIDINE, 4-(1H-PYRAZOL-1-YL)- |
CAS: | 252722-77-3 |
English Synonyms: | 1H-PYRROLO[2,3-D]PYRIMIDINE, 4-(1H-PYRAZOL-1-YL)- ; 4-(1H-PYRAZOL-1-YL)-1H-PYRROLO[2,3-D]PYRIMIDINE |
MDL Number.: | MFCD17013129 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cnn(c1)c2c-3ccnc3[nH]cn2 |
InChi: | InChI=1S/C9H7N5/c1-3-13-14(5-1)9-7-2-4-10-8(7)11-6-12-9/h1-6H,(H,10,11,12) |
InChiKey: | InChIKey=VXAXIOIDQGMFIP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.