* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOXAZOLO[4,5-C]PYRIDIN-6-AMINE |
CAS: | 1206972-88-4 |
English Synonyms: | [1,2]OXAZOLO[4,5-C]PYRIDIN-6-AMINE ; ISOXAZOLO[4,5-C]PYRIDIN-6-AMINE |
MDL Number.: | MFCD17013165 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1c2c(cnc1N)cno2 |
InChi: | InChI=1S/C6H5N3O/c7-6-1-5-4(2-8-6)3-9-10-5/h1-3H,(H2,7,8) |
InChiKey: | InChIKey=JCJPGNBRZQUNDC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.