* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(1-TRITYL-1H-IMIDAZOL-4-YL)PROPANE-1,3-DIOL |
| CAS: | 426219-41-2 |
| English Synonyms: | 1-(1-TRITYL-1H-IMIDAZOL-4-YL)PROPANE-1,3-DIOL ; 1-(1-TRITYL-1H-IMIDAZOL-4-YL)-1,3-PROPANEDIOL |
| MDL Number.: | MFCD17013180 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)C(c2ccccc2)(c3ccccc3)n4cc(nc4)C(CCO)O |
| InChi: | InChI=1S/C25H24N2O2/c28-17-16-24(29)23-18-27(19-26-23)25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,18-19,24,28-29H,16-17H2 |
| InChiKey: | InChIKey=ASEWWUUUGQVFDQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.